C35H42F6N6O — CID 174602695
bis[1-(4-cyclobutylpiperazin-1-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]cyclopropyl]methanone (PubChem CID 174602695) has the molecular formula C35H42F6N6O and a molecular weight of 676.75 g/mol. Its IUPAC name is bis[1-(4-cyclobutylpiperazin-1-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]cyclopropyl]methanone.
| Compound Name | bis[1-(4-cyclobutylpiperazin-1-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]cyclopropyl]methanone |
|---|---|
| PubChem CID | 174602695 |
| Molecular Formula | C35H42F6N6O |
| Molecular Weight | 676.75 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | bis[1-(4-cyclobutylpiperazin-1-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]cyclopropyl]methanone |
| SMILES | O=C(C1(N2CCN(C3CCC3)CC2)CC1c1ccc(C(F)(F)F)nc1)C1(N2CCN(C3CCC3)CC2)CC1c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C35H42F6N6O/c36-34(37,38)29-9-7-23(21-42-29)27-19-32(27,46-15-11-44(12-16-46)25-3-1-4-25)31(48)33(47-17-13-45(14-18-47)26-5-2-6-26)20-28(33)24-8-10-30(43-22-24)35(39,40)41/h7-10,21-22,25-28H,1-6,11-20H2 |
| InChIKey | GPNXFLNKOICFDO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.75 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |