About 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one
4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one (PubChem CID 174602776) has the molecular formula C13H17N3O3
and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one |
| PubChem CID | 174602776 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one |
| SMILES | Nc1cccc2c1CN(N1C(O)CCCC1O)C2=O |
| InChI | InChI=1S/C13H17N3O3/c14-10-4-1-3-8-9(10)7-15(13(8)19)16-11(17)5-2-6-12(16)18/h1,3-4,11-12,17-18H,2,5-7,14H2 |
| InChIKey | PMTPHIBJTYHXCY-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one?
The IUPAC name of 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one (CID 174602776) is 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one.
What is the SMILES notation for 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one?
The canonical SMILES for 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one is Nc1cccc2c1CN(N1C(O)CCCC1O)C2=O.
What is the InChIKey of 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one?
The InChIKey is PMTPHIBJTYHXCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3/c14-10-4-1-3-8-9(10)7-15(13(8)19)16-11(17)5-2-6-12(16)18/h1,3-4,11-12,17-18H,2,5-7,14H2.
What are the key properties of 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one?
4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one has a molecular weight of 263.30 g/mol, XLogP of 0.26, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(2,6-dihydroxypiperidin-1-yl)-3H-isoindol-1-one is sourced from PubChem (CID 174602776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).