C21H26F3NO4 — CID 174602879
(1S,9R,10S,15R)-13-(1,3-dioxolan-2-yl)-18-methyl-14-oxa-18-azapentacyclo[7.6.3.01,10.02,7.013,15]octadeca-2,4,6-trien-10-ol;fluoroform (PubChem CID 174602879) has the molecular formula C21H26F3NO4 and a molecular weight of 413.44 g/mol. Its IUPAC name is (1S,9R,10S,15R)-13-(1,3-dioxolan-2-yl)-18-methyl-14-oxa-18-azapentacyclo[7.6.3.01,10.02,7.013,15]octadeca-2,4,6-trien-10-ol;fluoroform.
| Compound Name | (1S,9R,10S,15R)-13-(1,3-dioxolan-2-yl)-18-methyl-14-oxa-18-azapentacyclo[7.6.3.01,10.02,7.013,15]octadeca-2,4,6-trien-10-ol;fluoroform |
|---|---|
| PubChem CID | 174602879 |
| Molecular Formula | C21H26F3NO4 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (1S,9R,10S,15R)-13-(1,3-dioxolan-2-yl)-18-methyl-14-oxa-18-azapentacyclo[7.6.3.01,10.02,7.013,15]octadeca-2,4,6-trien-10-ol;fluoroform |
| SMILES | CN1CC[C@@]23c4ccccc4C[C@@H]1[C@]2(O)CCC1(C2OCCO2)O[C@@H]13.FC(F)F |
| InChI | InChI=1S/C20H25NO4.CHF3/c1-21-9-8-18-14-5-3-2-4-13(14)12-15(21)20(18,22)7-6-19(16(18)25-19)17-23-10-11-24-17;2-1(3)4/h2-5,15-17,22H,6-12H2,1H3;1H/t15-,16-,18+,19?,20-;/m1./s1 |
| InChIKey | XOYUCFJWQOSNMX-WEOCIQOSSA-N |
| XLogP | 2.40 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|