About CID 174602937
CID 174602937 (PubChem CID 174602937) has the molecular formula C9H12B
and a molecular weight of 131.01 g/mol.
Molecular Properties
| Compound Name | CID 174602937 |
| PubChem CID | 174602937 |
| Molecular Formula | C9H12B |
| Molecular Weight | 131.01 g/mol |
| Exact Mass | 131.10 |
| IUPAC Name | — |
| SMILES | [BH]c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C9H12B/c1-6-4-7(2)9(10)8(3)5-6/h4-5,10H,1-3H3 |
| InChIKey | ZSAPMGOVLOBECM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.01 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174602937 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174602937?
The IUPAC name of CID 174602937 (CID 174602937) is not available.
What is the SMILES notation for CID 174602937?
The canonical SMILES for CID 174602937 is [BH]c1c(C)cc(C)cc1C.
What is the InChIKey of CID 174602937?
The InChIKey is ZSAPMGOVLOBECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12B/c1-6-4-7(2)9(10)8(3)5-6/h4-5,10H,1-3H3.
What are the key properties of CID 174602937?
CID 174602937 has a molecular weight of 131.01 g/mol, XLogP of 1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174602937 is sourced from PubChem (CID 174602937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).