About 4-methylbenzene-1,2-diamine;morpholine
4-methylbenzene-1,2-diamine;morpholine (PubChem CID 174603217) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-methylbenzene-1,2-diamine;morpholine.
Molecular Properties
| Compound Name | 4-methylbenzene-1,2-diamine;morpholine |
| PubChem CID | 174603217 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-methylbenzene-1,2-diamine;morpholine |
| SMILES | C1COCCN1.Cc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C7H10N2.C4H9NO/c1-5-2-3-6(8)7(9)4-5;1-3-6-4-2-5-1/h2-4H,8-9H2,1H3;5H,1-4H2 |
| InChIKey | IIVLGRDNUQLYCL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzene-1,2-diamine;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzene-1,2-diamine;morpholine?
The IUPAC name of 4-methylbenzene-1,2-diamine;morpholine (CID 174603217) is 4-methylbenzene-1,2-diamine;morpholine.
What is the SMILES notation for 4-methylbenzene-1,2-diamine;morpholine?
The canonical SMILES for 4-methylbenzene-1,2-diamine;morpholine is C1COCCN1.Cc1ccc(N)c(N)c1.
What is the InChIKey of 4-methylbenzene-1,2-diamine;morpholine?
The InChIKey is IIVLGRDNUQLYCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C4H9NO/c1-5-2-3-6(8)7(9)4-5;1-3-6-4-2-5-1/h2-4H,8-9H2,1H3;5H,1-4H2.
What are the key properties of 4-methylbenzene-1,2-diamine;morpholine?
4-methylbenzene-1,2-diamine;morpholine has a molecular weight of 209.29 g/mol, XLogP of 0.77, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzene-1,2-diamine;morpholine is sourced from PubChem (CID 174603217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).