About 2-methyltriazole;2,3,4-trimethylhexane
2-methyltriazole;2,3,4-trimethylhexane (PubChem CID 174603590) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-methyltriazole;2,3,4-trimethylhexane.
Molecular Properties
| Compound Name | 2-methyltriazole;2,3,4-trimethylhexane |
| PubChem CID | 174603590 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 2-methyltriazole;2,3,4-trimethylhexane |
| SMILES | CCC(C)C(C)C(C)C.Cn1nccn1 |
| InChI | InChI=1S/C9H20.C3H5N3/c1-6-8(4)9(5)7(2)3;1-6-4-2-3-5-6/h7-9H,6H2,1-5H3;2-3H,1H3 |
| InChIKey | VZYIWMCNCHOFKT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyltriazole;2,3,4-trimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyltriazole;2,3,4-trimethylhexane?
The IUPAC name of 2-methyltriazole;2,3,4-trimethylhexane (CID 174603590) is 2-methyltriazole;2,3,4-trimethylhexane.
What is the SMILES notation for 2-methyltriazole;2,3,4-trimethylhexane?
The canonical SMILES for 2-methyltriazole;2,3,4-trimethylhexane is CCC(C)C(C)C(C)C.Cn1nccn1.
What is the InChIKey of 2-methyltriazole;2,3,4-trimethylhexane?
The InChIKey is VZYIWMCNCHOFKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.C3H5N3/c1-6-8(4)9(5)7(2)3;1-6-4-2-3-5-6/h7-9H,6H2,1-5H3;2-3H,1H3.
What are the key properties of 2-methyltriazole;2,3,4-trimethylhexane?
2-methyltriazole;2,3,4-trimethylhexane has a molecular weight of 211.35 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyltriazole;2,3,4-trimethylhexane is sourced from PubChem (CID 174603590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).