About 3,5-diethyl-2H-1,3-thiazol-2-amine
3,5-diethyl-2H-1,3-thiazol-2-amine (PubChem CID 174603976) has the molecular formula C7H14N2S
and a molecular weight of 158.27 g/mol. Its IUPAC name is 3,5-diethyl-2H-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 3,5-diethyl-2H-1,3-thiazol-2-amine |
| PubChem CID | 174603976 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 3,5-diethyl-2H-1,3-thiazol-2-amine |
| SMILES | CCC1=CN(CC)C(N)S1 |
| InChI | InChI=1S/C7H14N2S/c1-3-6-5-9(4-2)7(8)10-6/h5,7H,3-4,8H2,1-2H3 |
| InChIKey | GPUFQSOSAONULL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-diethyl-2H-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-2H-1,3-thiazol-2-amine?
The IUPAC name of 3,5-diethyl-2H-1,3-thiazol-2-amine (CID 174603976) is 3,5-diethyl-2H-1,3-thiazol-2-amine.
What is the SMILES notation for 3,5-diethyl-2H-1,3-thiazol-2-amine?
The canonical SMILES for 3,5-diethyl-2H-1,3-thiazol-2-amine is CCC1=CN(CC)C(N)S1.
What is the InChIKey of 3,5-diethyl-2H-1,3-thiazol-2-amine?
The InChIKey is GPUFQSOSAONULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S/c1-3-6-5-9(4-2)7(8)10-6/h5,7H,3-4,8H2,1-2H3.
What are the key properties of 3,5-diethyl-2H-1,3-thiazol-2-amine?
3,5-diethyl-2H-1,3-thiazol-2-amine has a molecular weight of 158.27 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-2H-1,3-thiazol-2-amine is sourced from PubChem (CID 174603976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).