About sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane
sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane (PubChem CID 174604196) has the molecular formula C6H11NaO2S2
and a molecular weight of 202.28 g/mol. Its IUPAC name is sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane.
Molecular Properties
| Compound Name | sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane |
| PubChem CID | 174604196 |
| Molecular Formula | C6H11NaO2S2 |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane |
| SMILES | C=CCOS(=O)(=S)CC=C.[H-].[Na+] |
| InChI | InChI=1S/C6H10O2S2.Na.H/c1-3-5-8-10(7,9)6-4-2;;/h3-4H,1-2,5-6H2;;/q;+1;-1 |
| InChIKey | CUGVZTNXNDKSDT-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane?
The IUPAC name of sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane (CID 174604196) is sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane.
What is the SMILES notation for sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane?
The canonical SMILES for sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane is C=CCOS(=O)(=S)CC=C.[H-].[Na+].
What is the InChIKey of sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane?
The InChIKey is CUGVZTNXNDKSDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S2.Na.H/c1-3-5-8-10(7,9)6-4-2;;/h3-4H,1-2,5-6H2;;/q;+1;-1.
What are the key properties of sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane?
sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane has a molecular weight of 202.28 g/mol, XLogP of -1.85, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;oxo-prop-2-enoxy-prop-2-enyl-sulfanylidene-λ6-sulfane is sourced from PubChem (CID 174604196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).