About 1,3-benzoxazole;1,3-oxazole;1H-pyrrole
1,3-benzoxazole;1,3-oxazole;1H-pyrrole (PubChem CID 174604310) has the molecular formula C14H13N3O2
and a molecular weight of 255.28 g/mol. Its IUPAC name is 1,3-benzoxazole;1,3-oxazole;1H-pyrrole.
Molecular Properties
| Compound Name | 1,3-benzoxazole;1,3-oxazole;1H-pyrrole |
| PubChem CID | 174604310 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1,3-benzoxazole;1,3-oxazole;1H-pyrrole |
| SMILES | c1cc[nH]c1.c1ccc2ocnc2c1.c1cocn1 |
| InChI | InChI=1S/C7H5NO.C4H5N.C3H3NO/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-5-3-1;1-2-5-3-4-1/h1-5H;1-5H;1-3H |
| InChIKey | IXKJEXGHOLWVAE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-benzoxazole;1,3-oxazole;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzoxazole;1,3-oxazole;1H-pyrrole?
The IUPAC name of 1,3-benzoxazole;1,3-oxazole;1H-pyrrole (CID 174604310) is 1,3-benzoxazole;1,3-oxazole;1H-pyrrole.
What is the SMILES notation for 1,3-benzoxazole;1,3-oxazole;1H-pyrrole?
The canonical SMILES for 1,3-benzoxazole;1,3-oxazole;1H-pyrrole is c1cc[nH]c1.c1ccc2ocnc2c1.c1cocn1.
What is the InChIKey of 1,3-benzoxazole;1,3-oxazole;1H-pyrrole?
The InChIKey is IXKJEXGHOLWVAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO.C4H5N.C3H3NO/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-5-3-1;1-2-5-3-4-1/h1-5H;1-5H;1-3H.
What are the key properties of 1,3-benzoxazole;1,3-oxazole;1H-pyrrole?
1,3-benzoxazole;1,3-oxazole;1H-pyrrole has a molecular weight of 255.28 g/mol, XLogP of 3.52, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzoxazole;1,3-oxazole;1H-pyrrole is sourced from PubChem (CID 174604310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).