About 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane
3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane (PubChem CID 174604447) has the molecular formula C14H28O4Si
and a molecular weight of 288.46 g/mol. Its IUPAC name is 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane.
Molecular Properties
| Compound Name | 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane |
| PubChem CID | 174604447 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane |
| SMILES | CCCC1(OC)C(C2COC2)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C14H28O4Si/c1-5-8-14(15-2)13(12-10-18-11-12)7-6-9-19(14,16-3)17-4/h12-13H,5-11H2,1-4H3 |
| InChIKey | ZWWZIXOWQJTAGC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane?
The IUPAC name of 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane (CID 174604447) is 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane.
What is the SMILES notation for 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane?
The canonical SMILES for 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane is CCCC1(OC)C(C2COC2)CCC[Si]1(OC)OC.
What is the InChIKey of 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane?
The InChIKey is ZWWZIXOWQJTAGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O4Si/c1-5-8-14(15-2)13(12-10-18-11-12)7-6-9-19(14,16-3)17-4/h12-13H,5-11H2,1-4H3.
What are the key properties of 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane?
3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane has a molecular weight of 288.46 g/mol, XLogP of 2.50, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1,2-trimethoxy-2-propylsilinan-3-yl)oxetane is sourced from PubChem (CID 174604447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).