About N-ethylhydroxylamine;pyrrole-2,5-dione
N-ethylhydroxylamine;pyrrole-2,5-dione (PubChem CID 174604531) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is N-ethylhydroxylamine;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | N-ethylhydroxylamine;pyrrole-2,5-dione |
| PubChem CID | 174604531 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | N-ethylhydroxylamine;pyrrole-2,5-dione |
| SMILES | CCNO.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H3NO2.C2H7NO/c6-3-1-2-4(7)5-3;1-2-3-4/h1-2H,(H,5,6,7);3-4H,2H2,1H3 |
| InChIKey | OTGGJIPYUSQPBW-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-ethylhydroxylamine;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylhydroxylamine;pyrrole-2,5-dione?
The IUPAC name of N-ethylhydroxylamine;pyrrole-2,5-dione (CID 174604531) is N-ethylhydroxylamine;pyrrole-2,5-dione.
What is the SMILES notation for N-ethylhydroxylamine;pyrrole-2,5-dione?
The canonical SMILES for N-ethylhydroxylamine;pyrrole-2,5-dione is CCNO.O=C1C=CC(=O)N1.
What is the InChIKey of N-ethylhydroxylamine;pyrrole-2,5-dione?
The InChIKey is OTGGJIPYUSQPBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.C2H7NO/c6-3-1-2-4(7)5-3;1-2-3-4/h1-2H,(H,5,6,7);3-4H,2H2,1H3.
What are the key properties of N-ethylhydroxylamine;pyrrole-2,5-dione?
N-ethylhydroxylamine;pyrrole-2,5-dione has a molecular weight of 158.16 g/mol, XLogP of -0.82, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylhydroxylamine;pyrrole-2,5-dione is sourced from PubChem (CID 174604531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).