C23H28N4O7 — CID 174605178
2-[2-[[2-[4-(4-formyloxybutyl)piperazin-1-yl]-2-oxoethyl]carbamoyl]quinolin-4-yl]oxyacetic acid (PubChem CID 174605178) has the molecular formula C23H28N4O7 and a molecular weight of 472.50 g/mol. Its IUPAC name is 2-[2-[[2-[4-(4-formyloxybutyl)piperazin-1-yl]-2-oxoethyl]carbamoyl]quinolin-4-yl]oxyacetic acid.
| Compound Name | 2-[2-[[2-[4-(4-formyloxybutyl)piperazin-1-yl]-2-oxoethyl]carbamoyl]quinolin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 174605178 |
| Molecular Formula | C23H28N4O7 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 2-[2-[[2-[4-(4-formyloxybutyl)piperazin-1-yl]-2-oxoethyl]carbamoyl]quinolin-4-yl]oxyacetic acid |
| SMILES | O=COCCCCN1CCN(C(=O)CNC(=O)c2cc(OCC(=O)O)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C23H28N4O7/c28-16-33-12-4-3-7-26-8-10-27(11-9-26)21(29)14-24-23(32)19-13-20(34-15-22(30)31)17-5-1-2-6-18(17)25-19/h1-2,5-6,13,16H,3-4,7-12,14-15H2,(H,24,32)(H,30,31) |
| InChIKey | INWKSSQVGJRXCJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 138.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|