C27H29F2N3O3 — CID 174605597
5-fluoro-3-[[4-[(5-fluoro-2,3-dihydro-1,4-benzodioxin-6-yl)methylamino]piperidin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-11-carbaldehyde (PubChem CID 174605597) has the molecular formula C27H29F2N3O3 and a molecular weight of 481.54 g/mol. Its IUPAC name is 5-fluoro-3-[[4-[(5-fluoro-2,3-dihydro-1,4-benzodioxin-6-yl)methylamino]piperidin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-11-carbaldehyde.
| Compound Name | 5-fluoro-3-[[4-[(5-fluoro-2,3-dihydro-1,4-benzodioxin-6-yl)methylamino]piperidin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-11-carbaldehyde |
|---|---|
| PubChem CID | 174605597 |
| Molecular Formula | C27H29F2N3O3 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 5-fluoro-3-[[4-[(5-fluoro-2,3-dihydro-1,4-benzodioxin-6-yl)methylamino]piperidin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-11-carbaldehyde |
| SMILES | O=CC1C=Cc2ccc(F)c3c2N1CC3CN1CCC(NCc2ccc3c(c2F)OCCO3)CC1 |
| InChI | InChI=1S/C27H29F2N3O3/c28-22-5-2-17-1-4-21(16-33)32-15-19(24(22)26(17)32)14-31-9-7-20(8-10-31)30-13-18-3-6-23-27(25(18)29)35-12-11-34-23/h1-6,16,19-21,30H,7-15H2 |
| InChIKey | XAEPVYIXMGLWCZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|