C20H40O2S — CID 174606335
2-octylsulfanylethyl 2-tert-butyl-3,3-dimethylbutanoate (PubChem CID 174606335) has the molecular formula C20H40O2S and a molecular weight of 344.61 g/mol. Its IUPAC name is 2-octylsulfanylethyl 2-tert-butyl-3,3-dimethylbutanoate.
| Compound Name | 2-octylsulfanylethyl 2-tert-butyl-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 174606335 |
| Molecular Formula | C20H40O2S |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 2-octylsulfanylethyl 2-tert-butyl-3,3-dimethylbutanoate |
| SMILES | CCCCCCCCSCCOC(=O)C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H40O2S/c1-8-9-10-11-12-13-15-23-16-14-22-18(21)17(19(2,3)4)20(5,6)7/h17H,8-16H2,1-7H3 |
| InChIKey | FICAZSPXPZHZNZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|