C16H20F3N5S — CID 17460657
5-(4-methylphenyl)-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione (PubChem CID 17460657) has the molecular formula C16H20F3N5S and a molecular weight of 371.43 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-methylphenyl)-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17460657 |
| Molecular Formula | C16H20F3N5S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 5-(4-methylphenyl)-2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]-1H-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(-c2nc(=S)n(CN3CCN(CC(F)(F)F)CC3)[nH]2)cc1 |
| InChI | InChI=1S/C16H20F3N5S/c1-12-2-4-13(5-3-12)14-20-15(25)24(21-14)11-23-8-6-22(7-9-23)10-16(17,18)19/h2-5H,6-11H2,1H3,(H,20,21,25) |
| InChIKey | COBAILCZCSNNCP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|