C43H38F6N6O — CID 174606920
2,4-bis[1-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]-2,3-dihydroindol-5-yl]pentan-3-one (PubChem CID 174606920) has the molecular formula C43H38F6N6O and a molecular weight of 768.81 g/mol. Its IUPAC name is 2,4-bis[1-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]-2,3-dihydroindol-5-yl]pentan-3-one.
| Compound Name | 2,4-bis[1-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]-2,3-dihydroindol-5-yl]pentan-3-one |
|---|---|
| PubChem CID | 174606920 |
| Molecular Formula | C43H38F6N6O |
| Molecular Weight | 768.81 g/mol |
| Exact Mass | 768.30 |
| IUPAC Name | 2,4-bis[1-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]-2,3-dihydroindol-5-yl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1ccc2c(c1)CCN2Cc1cn[nH]c1-c1ccc(C(F)(F)F)cc1)c1ccc2c(c1)CCN2Cc1cn[nH]c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C43H38F6N6O/c1-25(29-7-13-37-31(19-29)15-17-54(37)23-33-21-50-52-39(33)27-3-9-35(10-4-27)42(44,45)46)41(56)26(2)30-8-14-38-32(20-30)16-18-55(38)24-34-22-51-53-40(34)28-5-11-36(12-6-28)43(47,48)49/h3-14,19-22,25-26H,15-18,23-24H2,1-2H3,(H,50,52)(H,51,53) |
| InChIKey | RYXQOCWZANJCDP-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.81 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |