C13H21NO3 — CID 174607568
methylcarbamic acid;3-pentan-2-ylphenol (PubChem CID 174607568) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is methylcarbamic acid;3-pentan-2-ylphenol.
| Compound Name | methylcarbamic acid;3-pentan-2-ylphenol |
|---|---|
| PubChem CID | 174607568 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | methylcarbamic acid;3-pentan-2-ylphenol |
| SMILES | CCCC(C)c1cccc(O)c1.CNC(=O)O |
| InChI | InChI=1S/C11H16O.C2H5NO2/c1-3-5-9(2)10-6-4-7-11(12)8-10;1-3-2(4)5/h4,6-9,12H,3,5H2,1-2H3;3H,1H3,(H,4,5) |
| InChIKey | YPTCZEAYWSTRFJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |