C20H18O4 — CID 174608535
2,2-diacetyl-3-phenyl-3,4-dihydrochromene-4-carbaldehyde (PubChem CID 174608535) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2,2-diacetyl-3-phenyl-3,4-dihydrochromene-4-carbaldehyde.
| Compound Name | 2,2-diacetyl-3-phenyl-3,4-dihydrochromene-4-carbaldehyde |
|---|---|
| PubChem CID | 174608535 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2,2-diacetyl-3-phenyl-3,4-dihydrochromene-4-carbaldehyde |
| SMILES | CC(=O)C1(C(C)=O)Oc2ccccc2C(C=O)C1c1ccccc1 |
| InChI | InChI=1S/C20H18O4/c1-13(22)20(14(2)23)19(15-8-4-3-5-9-15)17(12-21)16-10-6-7-11-18(16)24-20/h3-12,17,19H,1-2H3 |
| InChIKey | DBHZGEXIHKPGBF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|