C20H20N4O5S — CID 174608658
[5-[[6-(3-methoxyphenyl)pyrimidin-4-yl]carbamoyl]-N,2-dimethylanilino] hydrogen sulfite (PubChem CID 174608658) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is [5-[[6-(3-methoxyphenyl)pyrimidin-4-yl]carbamoyl]-N,2-dimethylanilino] hydrogen sulfite.
| Compound Name | [5-[[6-(3-methoxyphenyl)pyrimidin-4-yl]carbamoyl]-N,2-dimethylanilino] hydrogen sulfite |
|---|---|
| PubChem CID | 174608658 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | [5-[[6-(3-methoxyphenyl)pyrimidin-4-yl]carbamoyl]-N,2-dimethylanilino] hydrogen sulfite |
| SMILES | COc1cccc(-c2cc(NC(=O)c3ccc(C)c(N(C)OS(=O)O)c3)ncn2)c1 |
| InChI | InChI=1S/C20H20N4O5S/c1-13-7-8-15(10-18(13)24(2)29-30(26)27)20(25)23-19-11-17(21-12-22-19)14-5-4-6-16(9-14)28-3/h4-12H,1-3H3,(H,26,27)(H,21,22,23,25) |
| InChIKey | YEQMEQYRHIVQOH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|