About (2,5-dimethyl-1,3-thiazol-4-yl)stannane
(2,5-dimethyl-1,3-thiazol-4-yl)stannane (PubChem CID 174608722) has the molecular formula C5H9NSSn
and a molecular weight of 233.91 g/mol. Its IUPAC name is (2,5-dimethyl-1,3-thiazol-4-yl)stannane.
Molecular Properties
| Compound Name | (2,5-dimethyl-1,3-thiazol-4-yl)stannane |
| PubChem CID | 174608722 |
| Molecular Formula | C5H9NSSn |
| Molecular Weight | 233.91 g/mol |
| Exact Mass | 234.95 |
| IUPAC Name | (2,5-dimethyl-1,3-thiazol-4-yl)stannane |
| SMILES | Cc1nc([SnH3])c(C)s1 |
| InChI | InChI=1S/C5H6NS.Sn.3H/c1-4-3-6-5(2)7-4;;;;/h1-2H3;;;; |
| InChIKey | DOCHRZFWWUCQQN-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.91 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,5-dimethyl-1,3-thiazol-4-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethyl-1,3-thiazol-4-yl)stannane?
The IUPAC name of (2,5-dimethyl-1,3-thiazol-4-yl)stannane (CID 174608722) is (2,5-dimethyl-1,3-thiazol-4-yl)stannane.
What is the SMILES notation for (2,5-dimethyl-1,3-thiazol-4-yl)stannane?
The canonical SMILES for (2,5-dimethyl-1,3-thiazol-4-yl)stannane is Cc1nc([SnH3])c(C)s1.
What is the InChIKey of (2,5-dimethyl-1,3-thiazol-4-yl)stannane?
The InChIKey is DOCHRZFWWUCQQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6NS.Sn.3H/c1-4-3-6-5(2)7-4;;;;/h1-2H3;;;;.
What are the key properties of (2,5-dimethyl-1,3-thiazol-4-yl)stannane?
(2,5-dimethyl-1,3-thiazol-4-yl)stannane has a molecular weight of 233.91 g/mol, XLogP of -0.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethyl-1,3-thiazol-4-yl)stannane is sourced from PubChem (CID 174608722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).