C19H17Cl — CID 174608738
8-chloro-1-methyl-1,2,11,12-tetrahydrochrysene (PubChem CID 174608738) has the molecular formula C19H17Cl and a molecular weight of 280.80 g/mol. Its IUPAC name is 8-chloro-1-methyl-1,2,11,12-tetrahydrochrysene.
| Compound Name | 8-chloro-1-methyl-1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174608738 |
| Molecular Formula | C19H17Cl |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 8-chloro-1-methyl-1,2,11,12-tetrahydrochrysene |
| SMILES | CC1CC=CC2=C1CCc1c2ccc2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H17Cl/c1-12-3-2-4-17-15(12)9-10-18-16-8-6-14(20)11-13(16)5-7-19(17)18/h2,4-8,11-12H,3,9-10H2,1H3 |
| InChIKey | FAAOCYBFHWOUBB-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |