About 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene
1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene (PubChem CID 174609091) has the molecular formula C17H20OS
and a molecular weight of 272.41 g/mol. Its IUPAC name is 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene.
Molecular Properties
| Compound Name | 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene |
| PubChem CID | 174609091 |
| Molecular Formula | C17H20OS |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene |
| SMILES | C=Cc1ccc(SC)cc1.CCOc1ccccc1 |
| InChI | InChI=1S/C9H10S.C8H10O/c1-3-8-4-6-9(10-2)7-5-8;1-2-9-8-6-4-3-5-7-8/h3-7H,1H2,2H3;3-7H,2H2,1H3 |
| InChIKey | KIAZKGOYZACGJQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene?
The IUPAC name of 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene (CID 174609091) is 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene.
What is the SMILES notation for 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene?
The canonical SMILES for 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene is C=Cc1ccc(SC)cc1.CCOc1ccccc1.
What is the InChIKey of 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene?
The InChIKey is KIAZKGOYZACGJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10S.C8H10O/c1-3-8-4-6-9(10-2)7-5-8;1-2-9-8-6-4-3-5-7-8/h3-7H,1H2,2H3;3-7H,2H2,1H3.
What are the key properties of 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene?
1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene has a molecular weight of 272.41 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-methylsulfanylbenzene;ethoxybenzene is sourced from PubChem (CID 174609091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).