About N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide
N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 174609617) has the molecular formula C6H7N3O2S
and a molecular weight of 185.21 g/mol. Its IUPAC name is N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide |
| PubChem CID | 174609617 |
| Molecular Formula | C6H7N3O2S |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CC(=O)NC(=O)Cc1nncs1 |
| InChI | InChI=1S/C6H7N3O2S/c1-4(10)8-5(11)2-6-9-7-3-12-6/h3H,2H2,1H3,(H,8,10,11) |
| InChIKey | WIILSPDLYLWCMK-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide?
The IUPAC name of N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide (CID 174609617) is N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide.
What is the SMILES notation for N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide?
The canonical SMILES for N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide is CC(=O)NC(=O)Cc1nncs1.
What is the InChIKey of N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide?
The InChIKey is WIILSPDLYLWCMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2S/c1-4(10)8-5(11)2-6-9-7-3-12-6/h3H,2H2,1H3,(H,8,10,11).
What are the key properties of N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide?
N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide has a molecular weight of 185.21 g/mol, XLogP of -0.26, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-2-(1,3,4-thiadiazol-2-yl)acetamide is sourced from PubChem (CID 174609617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).