About azane;methyl 4-methylhexadecanoate
azane;methyl 4-methylhexadecanoate (PubChem CID 174610409) has the molecular formula C18H39NO2
and a molecular weight of 301.52 g/mol. Its IUPAC name is azane;methyl 4-methylhexadecanoate.
Molecular Properties
| Compound Name | azane;methyl 4-methylhexadecanoate |
| PubChem CID | 174610409 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | azane;methyl 4-methylhexadecanoate |
| SMILES | CCCCCCCCCCCCC(C)CCC(=O)OC.N |
| InChI | InChI=1S/C18H36O2.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-17(2)15-16-18(19)20-3;/h17H,4-16H2,1-3H3;1H3 |
| InChIKey | JOQLMRCRAHCJII-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;methyl 4-methylhexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methyl 4-methylhexadecanoate?
The IUPAC name of azane;methyl 4-methylhexadecanoate (CID 174610409) is azane;methyl 4-methylhexadecanoate.
What is the SMILES notation for azane;methyl 4-methylhexadecanoate?
The canonical SMILES for azane;methyl 4-methylhexadecanoate is CCCCCCCCCCCCC(C)CCC(=O)OC.N.
What is the InChIKey of azane;methyl 4-methylhexadecanoate?
The InChIKey is JOQLMRCRAHCJII-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-17(2)15-16-18(19)20-3;/h17H,4-16H2,1-3H3;1H3.
What are the key properties of azane;methyl 4-methylhexadecanoate?
azane;methyl 4-methylhexadecanoate has a molecular weight of 301.52 g/mol, XLogP of 6.05, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methyl 4-methylhexadecanoate is sourced from PubChem (CID 174610409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).