C16H24N6 — CID 174610419
1-N,3-N,5-N-trimethyl-4-[(3S)-3-(methylamino)-2,3-dihydro-1H-inden-5-yl]pyrazole-1,3,5-triamine (PubChem CID 174610419) has the molecular formula C16H24N6 and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-N,3-N,5-N-trimethyl-4-[(3S)-3-(methylamino)-2,3-dihydro-1H-inden-5-yl]pyrazole-1,3,5-triamine.
| Compound Name | 1-N,3-N,5-N-trimethyl-4-[(3S)-3-(methylamino)-2,3-dihydro-1H-inden-5-yl]pyrazole-1,3,5-triamine |
|---|---|
| PubChem CID | 174610419 |
| Molecular Formula | C16H24N6 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 1-N,3-N,5-N-trimethyl-4-[(3S)-3-(methylamino)-2,3-dihydro-1H-inden-5-yl]pyrazole-1,3,5-triamine |
| SMILES | CNc1nn(NC)c(NC)c1-c1ccc2c(c1)[C@@H](NC)CC2 |
| InChI | InChI=1S/C16H24N6/c1-17-13-8-7-10-5-6-11(9-12(10)13)14-15(18-2)21-22(20-4)16(14)19-3/h5-6,9,13,17,19-20H,7-8H2,1-4H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | BURKKJLNCJCYNU-ZDUSSCGKSA-N |
| XLogP | 2.01 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |