C14H19ClN2O8 — CID 174610619
[(3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate;1-chloro-2-nitrobenzene (PubChem CID 174610619) has the molecular formula C14H19ClN2O8 and a molecular weight of 378.77 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate;1-chloro-2-nitrobenzene.
| Compound Name | [(3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate;1-chloro-2-nitrobenzene |
|---|---|
| PubChem CID | 174610619 |
| Molecular Formula | C14H19ClN2O8 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [(3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] acetate;1-chloro-2-nitrobenzene |
| SMILES | CC(=O)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N.O=[N+]([O-])c1ccccc1Cl |
| InChI | InChI=1S/C8H15NO6.C6H4ClNO2/c1-3(11)14-8-5(9)7(13)6(12)4(2-10)15-8;7-5-3-1-2-4-6(5)8(9)10/h4-8,10,12-13H,2,9H2,1H3;1-4H/t4-,5-,6-,7-,8?;/m1./s1 |
| InChIKey | YYAWKVSFVLTKBV-FROKLYQUSA-N |
| XLogP | -0.44 |
| TPSA | 165.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|