About 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide
1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide (PubChem CID 174610648) has the molecular formula C21H25BrO4
and a molecular weight of 421.33 g/mol. Its IUPAC name is 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide.
Molecular Properties
| Compound Name | 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide |
| PubChem CID | 174610648 |
| Molecular Formula | C21H25BrO4 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide |
| SMILES | Br.CC1(C(=O)O)c2ccccc2Oc2ccccc21.CCC(O)C1CC1 |
| InChI | InChI=1S/C15H12O3.C6H12O.BrH/c1-15(14(16)17)10-6-2-4-8-12(10)18-13-9-5-3-7-11(13)15;1-2-6(7)5-3-4-5;/h2-9H,1H3,(H,16,17);5-7H,2-4H2,1H3;1H |
| InChIKey | TWQJYWGNRWGPJI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide?
The IUPAC name of 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide (CID 174610648) is 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide.
What is the SMILES notation for 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide?
The canonical SMILES for 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide is Br.CC1(C(=O)O)c2ccccc2Oc2ccccc21.CCC(O)C1CC1.
What is the InChIKey of 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide?
The InChIKey is TWQJYWGNRWGPJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3.C6H12O.BrH/c1-15(14(16)17)10-6-2-4-8-12(10)18-13-9-5-3-7-11(13)15;1-2-6(7)5-3-4-5;/h2-9H,1H3,(H,16,17);5-7H,2-4H2,1H3;1H.
What are the key properties of 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide?
1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide has a molecular weight of 421.33 g/mol, XLogP of 4.93, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylpropan-1-ol;9-methylxanthene-9-carboxylic acid;hydrobromide is sourced from PubChem (CID 174610648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).