C14H19N5O2S — CID 17461084
6-amino-3-methyl-5-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]-1-propylpyrimidine-2,4-dione (PubChem CID 17461084) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 6-amino-3-methyl-5-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]-1-propylpyrimidine-2,4-dione.
| Compound Name | 6-amino-3-methyl-5-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 17461084 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 6-amino-3-methyl-5-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]-1-propylpyrimidine-2,4-dione |
| SMILES | C=CCNc1nc(-c2c(N)n(CCC)c(=O)n(C)c2=O)cs1 |
| InChI | InChI=1S/C14H19N5O2S/c1-4-6-16-13-17-9(8-22-13)10-11(15)19(7-5-2)14(21)18(3)12(10)20/h4,8H,1,5-7,15H2,2-3H3,(H,16,17) |
| InChIKey | BCMMVFBDYPTFLC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|