C20H17Cl — CID 174611459
8-chloro-11-ethenyl-1,2,11,12-tetrahydrochrysene (PubChem CID 174611459) has the molecular formula C20H17Cl and a molecular weight of 292.81 g/mol. Its IUPAC name is 8-chloro-11-ethenyl-1,2,11,12-tetrahydrochrysene.
| Compound Name | 8-chloro-11-ethenyl-1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174611459 |
| Molecular Formula | C20H17Cl |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 8-chloro-11-ethenyl-1,2,11,12-tetrahydrochrysene |
| SMILES | C=CC1CC2=C(C=CCC2)c2ccc3cc(Cl)ccc3c21 |
| InChI | InChI=1S/C20H17Cl/c1-2-13-11-14-5-3-4-6-17(14)19-9-7-15-12-16(21)8-10-18(15)20(13)19/h2,4,6-10,12-13H,1,3,5,11H2 |
| InChIKey | QEWKGLHETNFWOO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|