About 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile
2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile (PubChem CID 174611650) has the molecular formula C25H29N3O2
and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile |
| PubChem CID | 174611650 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile |
| SMILES | CCCCN1C(=O)C(Cc2ccccc2C#N)N(C)C(=O)C1(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H29N3O2/c1-4-5-15-28-23(29)22(16-20-13-9-10-14-21(20)18-26)27(3)24(30)25(28,2)17-19-11-7-6-8-12-19/h6-14,22H,4-5,15-17H2,1-3H3 |
| InChIKey | OFGHAGUBZYFRKF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile?
The IUPAC name of 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile (CID 174611650) is 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile.
What is the SMILES notation for 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile?
The canonical SMILES for 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile is CCCCN1C(=O)C(Cc2ccccc2C#N)N(C)C(=O)C1(C)Cc1ccccc1.
What is the InChIKey of 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile?
The InChIKey is OFGHAGUBZYFRKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O2/c1-4-5-15-28-23(29)22(16-20-13-9-10-14-21(20)18-26)27(3)24(30)25(28,2)17-19-11-7-6-8-12-19/h6-14,22H,4-5,15-17H2,1-3H3.
What are the key properties of 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile?
2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile has a molecular weight of 403.53 g/mol, XLogP of 3.57, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-benzyl-4-butyl-1,5-dimethyl-3,6-dioxopiperazin-2-yl)methyl]benzonitrile is sourced from PubChem (CID 174611650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).