About 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene
2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene (PubChem CID 174611653) has the molecular formula C18H17FS
and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene.
Molecular Properties
| Compound Name | 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene |
| PubChem CID | 174611653 |
| Molecular Formula | C18H17FS |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene |
| SMILES | CCC1(c2cccs2)C=CC(c2ccccc2)=CC1F |
| InChI | InChI=1S/C18H17FS/c1-2-18(17-9-6-12-20-17)11-10-15(13-16(18)19)14-7-4-3-5-8-14/h3-13,16H,2H2,1H3 |
| InChIKey | GQWZDVMMJXNTME-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene?
The IUPAC name of 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene (CID 174611653) is 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene.
What is the SMILES notation for 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene?
The canonical SMILES for 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene is CCC1(c2cccs2)C=CC(c2ccccc2)=CC1F.
What is the InChIKey of 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene?
The InChIKey is GQWZDVMMJXNTME-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FS/c1-2-18(17-9-6-12-20-17)11-10-15(13-16(18)19)14-7-4-3-5-8-14/h3-13,16H,2H2,1H3.
What are the key properties of 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene?
2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene has a molecular weight of 284.40 g/mol, XLogP of 5.39, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethyl-6-fluoro-4-phenylcyclohexa-2,4-dien-1-yl)thiophene is sourced from PubChem (CID 174611653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).