C22H46O — CID 174611784
1-(3,3-dimethylnonoxy)-3,3-dimethylnonane (PubChem CID 174611784) has the molecular formula C22H46O and a molecular weight of 326.61 g/mol. Its IUPAC name is 1-(3,3-dimethylnonoxy)-3,3-dimethylnonane.
| Compound Name | 1-(3,3-dimethylnonoxy)-3,3-dimethylnonane |
|---|---|
| PubChem CID | 174611784 |
| Molecular Formula | C22H46O |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 326.35 |
| IUPAC Name | 1-(3,3-dimethylnonoxy)-3,3-dimethylnonane |
| SMILES | CCCCCCC(C)(C)CCOCCC(C)(C)CCCCCC |
| InChI | InChI=1S/C22H46O/c1-7-9-11-13-15-21(3,4)17-19-23-20-18-22(5,6)16-14-12-10-8-2/h7-20H2,1-6H3 |
| InChIKey | ZCPAMDHIDIIARV-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|