About ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene
ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene (PubChem CID 174611825) has the molecular formula C31H24O
and a molecular weight of 412.53 g/mol. Its IUPAC name is ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene.
Molecular Properties
| Compound Name | ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene |
| PubChem CID | 174611825 |
| Molecular Formula | C31H24O |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene |
| SMILES | C=C=O.c1ccc(C2=C(c3ccccc3)C(c3ccccc3)=C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C29H22.C2H2O/c1-5-13-22(14-6-1)26-21-27(23-15-7-2-8-16-23)29(25-19-11-4-12-20-25)28(26)24-17-9-3-10-18-24;1-2-3/h1-20H,21H2;1H2 |
| InChIKey | IRXAOFFAZQDNNO-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene?
The IUPAC name of ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene (CID 174611825) is ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene.
What is the SMILES notation for ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene?
The canonical SMILES for ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene is C=C=O.c1ccc(C2=C(c3ccccc3)C(c3ccccc3)=C(c3ccccc3)C2)cc1.
What is the InChIKey of ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene?
The InChIKey is IRXAOFFAZQDNNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22.C2H2O/c1-5-13-22(14-6-1)26-21-27(23-15-7-2-8-16-23)29(25-19-11-4-12-20-25)28(26)24-17-9-3-10-18-24;1-2-3/h1-20H,21H2;1H2.
What are the key properties of ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene?
ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene has a molecular weight of 412.53 g/mol, XLogP of 7.62, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethenone;(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene is sourced from PubChem (CID 174611825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).