About furo[3,2-b]pyridine;1,3-thiazole
furo[3,2-b]pyridine;1,3-thiazole (PubChem CID 174612014) has the molecular formula C10H8N2OS
and a molecular weight of 204.25 g/mol. Its IUPAC name is furo[3,2-b]pyridine;1,3-thiazole.
Molecular Properties
| Compound Name | furo[3,2-b]pyridine;1,3-thiazole |
| PubChem CID | 174612014 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | furo[3,2-b]pyridine;1,3-thiazole |
| SMILES | c1cnc2ccoc2c1.c1cscn1 |
| InChI | InChI=1S/C7H5NO.C3H3NS/c1-2-7-6(8-4-1)3-5-9-7;1-2-5-3-4-1/h1-5H;1-3H |
| InChIKey | WOBKZISFJFUTMX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze furo[3,2-b]pyridine;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-b]pyridine;1,3-thiazole?
The IUPAC name of furo[3,2-b]pyridine;1,3-thiazole (CID 174612014) is furo[3,2-b]pyridine;1,3-thiazole.
What is the SMILES notation for furo[3,2-b]pyridine;1,3-thiazole?
The canonical SMILES for furo[3,2-b]pyridine;1,3-thiazole is c1cnc2ccoc2c1.c1cscn1.
What is the InChIKey of furo[3,2-b]pyridine;1,3-thiazole?
The InChIKey is WOBKZISFJFUTMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO.C3H3NS/c1-2-7-6(8-4-1)3-5-9-7;1-2-5-3-4-1/h1-5H;1-3H.
What are the key properties of furo[3,2-b]pyridine;1,3-thiazole?
furo[3,2-b]pyridine;1,3-thiazole has a molecular weight of 204.25 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-b]pyridine;1,3-thiazole is sourced from PubChem (CID 174612014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).