C19H24N4O3 — CID 17461264
3,5-dimethoxy-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]benzamide (PubChem CID 17461264) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 17461264 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 3,5-dimethoxy-N-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(N3CCN(C)CC3)nc2)c1 |
| InChI | InChI=1S/C19H24N4O3/c1-22-6-8-23(9-7-22)18-5-4-15(13-20-18)21-19(24)14-10-16(25-2)12-17(11-14)26-3/h4-5,10-13H,6-9H2,1-3H3,(H,21,24) |
| InChIKey | LOHZBAULSPCNSD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |