About ethane-1,2-diol;purin-9-amine
ethane-1,2-diol;purin-9-amine (PubChem CID 174612658) has the molecular formula C7H11N5O2
and a molecular weight of 197.20 g/mol. Its IUPAC name is ethane-1,2-diol;purin-9-amine.
Molecular Properties
| Compound Name | ethane-1,2-diol;purin-9-amine |
| PubChem CID | 174612658 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | ethane-1,2-diol;purin-9-amine |
| SMILES | Nn1cnc2cncnc21.OCCO |
| InChI | InChI=1S/C5H5N5.C2H6O2/c6-10-3-9-4-1-7-2-8-5(4)10;3-1-2-4/h1-3H,6H2;3-4H,1-2H2 |
| InChIKey | OUKNHFYUGXWHGQ-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethane-1,2-diol;purin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;purin-9-amine?
The IUPAC name of ethane-1,2-diol;purin-9-amine (CID 174612658) is ethane-1,2-diol;purin-9-amine.
What is the SMILES notation for ethane-1,2-diol;purin-9-amine?
The canonical SMILES for ethane-1,2-diol;purin-9-amine is Nn1cnc2cncnc21.OCCO.
What is the InChIKey of ethane-1,2-diol;purin-9-amine?
The InChIKey is OUKNHFYUGXWHGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5.C2H6O2/c6-10-3-9-4-1-7-2-8-5(4)10;3-1-2-4/h1-3H,6H2;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;purin-9-amine?
ethane-1,2-diol;purin-9-amine has a molecular weight of 197.20 g/mol, XLogP of -1.49, 1 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;purin-9-amine is sourced from PubChem (CID 174612658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).