C39H49N3O8 — CID 174613117
2-[2-[[3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-methylbutoxy]ethyl propanoate (PubChem CID 174613117) has the molecular formula C39H49N3O8 and a molecular weight of 687.83 g/mol. Its IUPAC name is 2-[2-[[3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-methylbutoxy]ethyl propanoate.
| Compound Name | 2-[2-[[3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-methylbutoxy]ethyl propanoate |
|---|---|
| PubChem CID | 174613117 |
| Molecular Formula | C39H49N3O8 |
| Molecular Weight | 687.83 g/mol |
| Exact Mass | 687.35 |
| IUPAC Name | 2-[2-[[3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-methylbutoxy]ethyl propanoate |
| SMILES | CCC(=O)OCCOCC(NC(=O)C(Cc1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1)NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C39H49N3O8/c1-7-35(43)48-21-20-47-24-34(25(2)3)41-36(44)33(42-38(46)50-39(4,5)6)22-26-16-18-27(19-17-26)40-37(45)49-23-32-30-14-10-8-12-28(30)29-13-9-11-15-31(29)32/h8-19,25,32-34H,7,20-24H2,1-6H3,(H,40,45)(H,41,44)(H,42,46) |
| InChIKey | HFGHQAMKIAWGKU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.83 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|