C20H23N3O4 — CID 17461318
4-benzoyl-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]piperidine-1-carboxamide (PubChem CID 17461318) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-benzoyl-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]piperidine-1-carboxamide.
| Compound Name | 4-benzoyl-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 17461318 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-benzoyl-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]piperidine-1-carboxamide |
| SMILES | O=C(CNC(=O)N1CCC(C(=O)c2ccccc2)CC1)NCc1ccco1 |
| InChI | InChI=1S/C20H23N3O4/c24-18(21-13-17-7-4-12-27-17)14-22-20(26)23-10-8-16(9-11-23)19(25)15-5-2-1-3-6-15/h1-7,12,16H,8-11,13-14H2,(H,21,24)(H,22,26) |
| InChIKey | FTHLBSMUGOEJAR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |