C8H12F4 — CID 174613396
1,1,2,8-tetrafluorooct-4-ene (PubChem CID 174613396) has the molecular formula C8H12F4 and a molecular weight of 184.18 g/mol. Its IUPAC name is 1,1,2,8-tetrafluorooct-4-ene.
| Compound Name | 1,1,2,8-tetrafluorooct-4-ene |
|---|---|
| PubChem CID | 174613396 |
| Molecular Formula | C8H12F4 |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 1,1,2,8-tetrafluorooct-4-ene |
| SMILES | FCCCC=CCC(F)C(F)F |
| InChI | InChI=1S/C8H12F4/c9-6-4-2-1-3-5-7(10)8(11)12/h1,3,7-8H,2,4-6H2 |
| InChIKey | HMOMGNPFCRPMRC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|