C21H20FN3O2 — CID 174613635
9-amino-2-ethyl-5-(4-fluoro-3-methoxyphenyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde (PubChem CID 174613635) has the molecular formula C21H20FN3O2 and a molecular weight of 365.41 g/mol. Its IUPAC name is 9-amino-2-ethyl-5-(4-fluoro-3-methoxyphenyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde.
| Compound Name | 9-amino-2-ethyl-5-(4-fluoro-3-methoxyphenyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 174613635 |
| Molecular Formula | C21H20FN3O2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 9-amino-2-ethyl-5-(4-fluoro-3-methoxyphenyl)-1,3-dihydropyrrolo[3,4-b]quinoline-1-carbaldehyde |
| SMILES | CCN1Cc2nc3c(-c4ccc(F)c(OC)c4)cccc3c(N)c2C1C=O |
| InChI | InChI=1S/C21H20FN3O2/c1-3-25-10-16-19(17(25)11-26)20(23)14-6-4-5-13(21(14)24-16)12-7-8-15(22)18(9-12)27-2/h4-9,11,17H,3,10H2,1-2H3,(H2,23,24) |
| InChIKey | ROFLGSKINFEETL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|