C20H22N4S3 — CID 17461382
5-cyclopropyl-4-prop-2-enyl-2-[(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 17461382) has the molecular formula C20H22N4S3 and a molecular weight of 414.63 g/mol. Its IUPAC name is 5-cyclopropyl-4-prop-2-enyl-2-[(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-cyclopropyl-4-prop-2-enyl-2-[(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17461382 |
| Molecular Formula | C20H22N4S3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 5-cyclopropyl-4-prop-2-enyl-2-[(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(C2CC2)nn(CN2CCc3sccc3C2c2cccs2)c1=S |
| InChI | InChI=1S/C20H22N4S3/c1-2-9-23-19(14-5-6-14)21-24(20(23)25)13-22-10-7-16-15(8-12-27-16)18(22)17-4-3-11-26-17/h2-4,8,11-12,14,18H,1,5-7,9-10,13H2 |
| InChIKey | QLSAZTYPBTWANU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|