About sodium;2,2,2-tribromoacetaldehyde;phenoxide
sodium;2,2,2-tribromoacetaldehyde;phenoxide (PubChem CID 174614034) has the molecular formula C8H6Br3NaO2
and a molecular weight of 396.84 g/mol. Its IUPAC name is sodium;2,2,2-tribromoacetaldehyde;phenoxide.
Molecular Properties
| Compound Name | sodium;2,2,2-tribromoacetaldehyde;phenoxide |
| PubChem CID | 174614034 |
| Molecular Formula | C8H6Br3NaO2 |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 393.78 |
| IUPAC Name | sodium;2,2,2-tribromoacetaldehyde;phenoxide |
| SMILES | O=CC(Br)(Br)Br.[Na+].[O-]c1ccccc1 |
| InChI | InChI=1S/C6H6O.C2HBr3O.Na/c7-6-4-2-1-3-5-6;3-2(4,5)1-6;/h1-5,7H;1H;/q;;+1/p-1 |
| InChIKey | QNJLNNXFBDILEL-UHFFFAOYSA-M |
| XLogP | -0.21 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze sodium;2,2,2-tribromoacetaldehyde;phenoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2,2,2-tribromoacetaldehyde;phenoxide?
The IUPAC name of sodium;2,2,2-tribromoacetaldehyde;phenoxide (CID 174614034) is sodium;2,2,2-tribromoacetaldehyde;phenoxide.
What is the SMILES notation for sodium;2,2,2-tribromoacetaldehyde;phenoxide?
The canonical SMILES for sodium;2,2,2-tribromoacetaldehyde;phenoxide is O=CC(Br)(Br)Br.[Na+].[O-]c1ccccc1.
What is the InChIKey of sodium;2,2,2-tribromoacetaldehyde;phenoxide?
The InChIKey is QNJLNNXFBDILEL-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O.C2HBr3O.Na/c7-6-4-2-1-3-5-6;3-2(4,5)1-6;/h1-5,7H;1H;/q;;+1/p-1.
What are the key properties of sodium;2,2,2-tribromoacetaldehyde;phenoxide?
sodium;2,2,2-tribromoacetaldehyde;phenoxide has a molecular weight of 396.84 g/mol, XLogP of -0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2,2,2-tribromoacetaldehyde;phenoxide is sourced from PubChem (CID 174614034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).