C22H17FN2O3 — CID 174614274
[5-cyclopropyl-2-[[6-(2-fluorophenyl)pyridine-3-carbonyl]amino]phenyl] formate (PubChem CID 174614274) has the molecular formula C22H17FN2O3 and a molecular weight of 376.39 g/mol. Its IUPAC name is [5-cyclopropyl-2-[[6-(2-fluorophenyl)pyridine-3-carbonyl]amino]phenyl] formate.
| Compound Name | [5-cyclopropyl-2-[[6-(2-fluorophenyl)pyridine-3-carbonyl]amino]phenyl] formate |
|---|---|
| PubChem CID | 174614274 |
| Molecular Formula | C22H17FN2O3 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [5-cyclopropyl-2-[[6-(2-fluorophenyl)pyridine-3-carbonyl]amino]phenyl] formate |
| SMILES | O=COc1cc(C2CC2)ccc1NC(=O)c1ccc(-c2ccccc2F)nc1 |
| InChI | InChI=1S/C22H17FN2O3/c23-18-4-2-1-3-17(18)19-9-8-16(12-24-19)22(27)25-20-10-7-15(14-5-6-14)11-21(20)28-13-26/h1-4,7-14H,5-6H2,(H,25,27) |
| InChIKey | STMPQVZSMCHJSW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|