C34H35N5O — CID 174614460
N-[[5-(22,24-dihydroporphyrin-2-yl)-2-methoxyphenyl]methyl]-N-propylpropan-1-amine (PubChem CID 174614460) has the molecular formula C34H35N5O and a molecular weight of 529.69 g/mol. Its IUPAC name is N-[[5-(22,24-dihydroporphyrin-2-yl)-2-methoxyphenyl]methyl]-N-propylpropan-1-amine.
| Compound Name | N-[[5-(22,24-dihydroporphyrin-2-yl)-2-methoxyphenyl]methyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 174614460 |
| Molecular Formula | C34H35N5O |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | N-[[5-(22,24-dihydroporphyrin-2-yl)-2-methoxyphenyl]methyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)Cc1cc(C2=Cc3cc4ccc(cc5nc(cc6ccc(cc2n3)[nH]6)C=C5)[nH]4)ccc1OC |
| InChI | InChI=1S/C34H35N5O/c1-4-14-39(15-5-2)22-24-16-23(6-13-34(24)40-3)32-20-31-19-29-10-9-27(36-29)17-25-7-8-26(35-25)18-28-11-12-30(37-28)21-33(32)38-31/h6-13,16-21,36-37H,4-5,14-15,22H2,1-3H3/b25-17-,26-18-,27-17-,28-18-,29-19-,30-21-,31-19-,33-21- |
| InChIKey | YFWKERXAAWWVLN-BNTNMXNASA-N |
| XLogP | 7.70 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |