About 1-(3-nitrophenyl)ethyl sulfite
1-(3-nitrophenyl)ethyl sulfite (PubChem CID 174614635) has the molecular formula C8H8NO5S-
and a molecular weight of 230.22 g/mol. Its IUPAC name is 1-(3-nitrophenyl)ethyl sulfite.
Molecular Properties
| Compound Name | 1-(3-nitrophenyl)ethyl sulfite |
| PubChem CID | 174614635 |
| Molecular Formula | C8H8NO5S- |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 1-(3-nitrophenyl)ethyl sulfite |
| SMILES | CC(OS(=O)[O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H9NO5S/c1-6(14-15(12)13)7-3-2-4-8(5-7)9(10)11/h2-6H,1H3,(H,12,13)/p-1 |
| InChIKey | WNANHHYPCKOYCA-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-nitrophenyl)ethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-nitrophenyl)ethyl sulfite?
The IUPAC name of 1-(3-nitrophenyl)ethyl sulfite (CID 174614635) is 1-(3-nitrophenyl)ethyl sulfite.
What is the SMILES notation for 1-(3-nitrophenyl)ethyl sulfite?
The canonical SMILES for 1-(3-nitrophenyl)ethyl sulfite is CC(OS(=O)[O-])c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 1-(3-nitrophenyl)ethyl sulfite?
The InChIKey is WNANHHYPCKOYCA-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9NO5S/c1-6(14-15(12)13)7-3-2-4-8(5-7)9(10)11/h2-6H,1H3,(H,12,13)/p-1.
What are the key properties of 1-(3-nitrophenyl)ethyl sulfite?
1-(3-nitrophenyl)ethyl sulfite has a molecular weight of 230.22 g/mol, XLogP of 1.47, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-nitrophenyl)ethyl sulfite is sourced from PubChem (CID 174614635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).