About 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane
7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane (PubChem CID 174614993) has the molecular formula C6H6OS
and a molecular weight of 126.18 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane.
Molecular Properties
| Compound Name | 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane |
| PubChem CID | 174614993 |
| Molecular Formula | C6H6OS |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.01 |
| IUPAC Name | 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane |
| SMILES | S.c1ccc2c(c1)O2 |
| InChI | InChI=1S/C6H4O.H2S/c1-2-4-6-5(3-1)7-6;/h1-4H;1H2 |
| InChIKey | MNEQEWWRWAEOPR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane?
The IUPAC name of 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane (CID 174614993) is 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane.
What is the SMILES notation for 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane?
The canonical SMILES for 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane is S.c1ccc2c(c1)O2.
What is the InChIKey of 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane?
The InChIKey is MNEQEWWRWAEOPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O.H2S/c1-2-4-6-5(3-1)7-6;/h1-4H;1H2.
What are the key properties of 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane?
7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane has a molecular weight of 126.18 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[4.1.0]hepta-1,3,5-triene;sulfane is sourced from PubChem (CID 174614993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).