About tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate
tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate (PubChem CID 174615627) has the molecular formula C11H19FO4
and a molecular weight of 234.27 g/mol. Its IUPAC name is tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate.
Molecular Properties
| Compound Name | tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate |
| PubChem CID | 174615627 |
| Molecular Formula | C11H19FO4 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate |
| SMILES | C=CCC(F)C(O)C(O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19FO4/c1-5-6-7(12)8(13)9(14)10(15)16-11(2,3)4/h5,7-9,13-14H,1,6H2,2-4H3 |
| InChIKey | AKKAZQHKTFVNGP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate?
The IUPAC name of tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate (CID 174615627) is tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate.
What is the SMILES notation for tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate?
The canonical SMILES for tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate is C=CCC(F)C(O)C(O)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate?
The InChIKey is AKKAZQHKTFVNGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FO4/c1-5-6-7(12)8(13)9(14)10(15)16-11(2,3)4/h5,7-9,13-14H,1,6H2,2-4H3.
What are the key properties of tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate?
tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate has a molecular weight of 234.27 g/mol, XLogP of 0.96, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-fluoro-2,3-dihydroxyhept-6-enoate is sourced from PubChem (CID 174615627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).