About 4-bromo-2,3-dihydroinden-1-one;methanamine
4-bromo-2,3-dihydroinden-1-one;methanamine (PubChem CID 174616015) has the molecular formula C12H22BrN3O
and a molecular weight of 304.23 g/mol. Its IUPAC name is 4-bromo-2,3-dihydroinden-1-one;methanamine.
Molecular Properties
| Compound Name | 4-bromo-2,3-dihydroinden-1-one;methanamine |
| PubChem CID | 174616015 |
| Molecular Formula | C12H22BrN3O |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-bromo-2,3-dihydroinden-1-one;methanamine |
| SMILES | CN.CN.CN.O=C1CCc2c(Br)cccc21 |
| InChI | InChI=1S/C9H7BrO.3CH5N/c10-8-3-1-2-7-6(8)4-5-9(7)11;3*1-2/h1-3H,4-5H2;3*2H2,1H3 |
| InChIKey | IBXXEQUQZRFABI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-2,3-dihydroinden-1-one;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,3-dihydroinden-1-one;methanamine?
The IUPAC name of 4-bromo-2,3-dihydroinden-1-one;methanamine (CID 174616015) is 4-bromo-2,3-dihydroinden-1-one;methanamine.
What is the SMILES notation for 4-bromo-2,3-dihydroinden-1-one;methanamine?
The canonical SMILES for 4-bromo-2,3-dihydroinden-1-one;methanamine is CN.CN.CN.O=C1CCc2c(Br)cccc21.
What is the InChIKey of 4-bromo-2,3-dihydroinden-1-one;methanamine?
The InChIKey is IBXXEQUQZRFABI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrO.3CH5N/c10-8-3-1-2-7-6(8)4-5-9(7)11;3*1-2/h1-3H,4-5H2;3*2H2,1H3.
What are the key properties of 4-bromo-2,3-dihydroinden-1-one;methanamine?
4-bromo-2,3-dihydroinden-1-one;methanamine has a molecular weight of 304.23 g/mol, XLogP of 1.30, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,3-dihydroinden-1-one;methanamine is sourced from PubChem (CID 174616015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).