About 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate
6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate (PubChem CID 174616019) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate.
Molecular Properties
| Compound Name | 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate |
| PubChem CID | 174616019 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate |
| SMILES | CCOC(=O)C(C)CC.O=C1Nc2cccc1c2 |
| InChI | InChI=1S/C7H5NO.C7H14O2/c9-7-5-2-1-3-6(4-5)8-7;1-4-6(3)7(8)9-5-2/h1-4H,(H,8,9);6H,4-5H2,1-3H3 |
| InChIKey | KPVMKJUTJHIGLW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate?
The IUPAC name of 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate (CID 174616019) is 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate.
What is the SMILES notation for 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate?
The canonical SMILES for 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate is CCOC(=O)C(C)CC.O=C1Nc2cccc1c2.
What is the InChIKey of 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate?
The InChIKey is KPVMKJUTJHIGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO.C7H14O2/c9-7-5-2-1-3-6(4-5)8-7;1-4-6(3)7(8)9-5-2/h1-4H,(H,8,9);6H,4-5H2,1-3H3.
What are the key properties of 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate?
6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate has a molecular weight of 249.31 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azabicyclo[3.2.1]octa-1(8),2,4-trien-7-one;ethyl 2-methylbutanoate is sourced from PubChem (CID 174616019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).