About tert-butyl formate;3-phenyl-1H-indazol-6-ol
tert-butyl formate;3-phenyl-1H-indazol-6-ol (PubChem CID 174616120) has the molecular formula C18H20N2O3
and a molecular weight of 312.37 g/mol. Its IUPAC name is tert-butyl formate;3-phenyl-1H-indazol-6-ol.
Molecular Properties
| Compound Name | tert-butyl formate;3-phenyl-1H-indazol-6-ol |
| PubChem CID | 174616120 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | tert-butyl formate;3-phenyl-1H-indazol-6-ol |
| SMILES | CC(C)(C)OC=O.Oc1ccc2c(-c3ccccc3)n[nH]c2c1 |
| InChI | InChI=1S/C13H10N2O.C5H10O2/c16-10-6-7-11-12(8-10)14-15-13(11)9-4-2-1-3-5-9;1-5(2,3)7-4-6/h1-8,16H,(H,14,15);4H,1-3H3 |
| InChIKey | DZPNEESUSQWRCP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;3-phenyl-1H-indazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;3-phenyl-1H-indazol-6-ol?
The IUPAC name of tert-butyl formate;3-phenyl-1H-indazol-6-ol (CID 174616120) is tert-butyl formate;3-phenyl-1H-indazol-6-ol.
What is the SMILES notation for tert-butyl formate;3-phenyl-1H-indazol-6-ol?
The canonical SMILES for tert-butyl formate;3-phenyl-1H-indazol-6-ol is CC(C)(C)OC=O.Oc1ccc2c(-c3ccccc3)n[nH]c2c1.
What is the InChIKey of tert-butyl formate;3-phenyl-1H-indazol-6-ol?
The InChIKey is DZPNEESUSQWRCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O.C5H10O2/c16-10-6-7-11-12(8-10)14-15-13(11)9-4-2-1-3-5-9;1-5(2,3)7-4-6/h1-8,16H,(H,14,15);4H,1-3H3.
What are the key properties of tert-butyl formate;3-phenyl-1H-indazol-6-ol?
tert-butyl formate;3-phenyl-1H-indazol-6-ol has a molecular weight of 312.37 g/mol, XLogP of 3.89, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;3-phenyl-1H-indazol-6-ol is sourced from PubChem (CID 174616120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).